About N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine
N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine (PubChem CID 43719371) has the molecular formula C11H13FN2O4S
and a molecular weight of 288.30 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine |
| PubChem CID | 43719371 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=[N+]([O-])c1cc(NC2CCS(=O)(=O)CC2)ccc1F |
| InChI | InChI=1S/C11H13FN2O4S/c12-10-2-1-9(7-11(10)14(15)16)13-8-3-5-19(17,18)6-4-8/h1-2,7-8,13H,3-6H2 |
| InChIKey | VLOYFALFWVYTEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine?
The IUPAC name of N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine (CID 43719371) is N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine.
What is the SMILES notation for N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine?
The canonical SMILES for N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine is O=[N+]([O-])c1cc(NC2CCS(=O)(=O)CC2)ccc1F.
What is the InChIKey of N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine?
The InChIKey is VLOYFALFWVYTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O4S/c12-10-2-1-9(7-11(10)14(15)16)13-8-3-5-19(17,18)6-4-8/h1-2,7-8,13H,3-6H2.
What are the key properties of N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine?
N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine has a molecular weight of 288.30 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine is sourced from PubChem (CID 43719371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).