C11H13FN2O4S — CID 43719371
N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine (PubChem CID 43719371) has the molecular formula C11H13FN2O4S and a molecular weight of 288.30 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43719371 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=[N+]([O-])c1cc(NC2CCS(=O)(=O)CC2)ccc1F |
| InChI | InChI=1S/C11H13FN2O4S/c12-10-2-1-9(7-11(10)14(15)16)13-8-3-5-19(17,18)6-4-8/h1-2,7-8,13H,3-6H2 |
| InChIKey | VLOYFALFWVYTEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|