C11H14N2O4S — CID 43615402
N-(2-nitrophenyl)-1,1-dioxothian-4-amine (PubChem CID 43615402) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(2-nitrophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-nitrophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43615402 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-(2-nitrophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=[N+]([O-])c1ccccc1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H14N2O4S/c14-13(15)11-4-2-1-3-10(11)12-9-5-7-18(16,17)8-6-9/h1-4,9,12H,5-8H2 |
| InChIKey | BZMUHBGACXCMIL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|