C12H16N2O4S — CID 63909898
N-(2-methyl-3-nitrophenyl)-1,1-dioxothian-3-amine (PubChem CID 63909898) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(2-methyl-3-nitrophenyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63909898 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-1,1-dioxothian-3-amine |
| SMILES | Cc1c(NC2CCCS(=O)(=O)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O4S/c1-9-11(5-2-6-12(9)14(15)16)13-10-4-3-7-19(17,18)8-10/h2,5-6,10,13H,3-4,7-8H2,1H3 |
| InChIKey | IQTAGBVUHGZTBC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|