C12H16N2O4S — CID 81039873
N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-3-nitroaniline (PubChem CID 81039873) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-3-nitroaniline.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-3-nitroaniline |
|---|---|
| PubChem CID | 81039873 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-3-nitroaniline |
| SMILES | Cc1c(NCC2CCCS2(=O)=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O4S/c1-9-11(5-2-6-12(9)14(15)16)13-8-10-4-3-7-19(10,17)18/h2,5-6,10,13H,3-4,7-8H2,1H3 |
| InChIKey | HBCLFQBDCAEPRE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|