C10H15N5O4S — CID 81046261
N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 81046261) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 81046261 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | NNc1ccc([N+](=O)[O-])c(NCC2CCCS2(=O)=O)n1 |
| InChI | InChI=1S/C10H15N5O4S/c11-14-9-4-3-8(15(16)17)10(13-9)12-6-7-2-1-5-20(7,18)19/h3-4,7H,1-2,5-6,11H2,(H2,12,13,14) |
| InChIKey | XRYMANNXQUGXLK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|