C10H15N5O3 — CID 80913877
1-cyclopropyl-2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanol (PubChem CID 80913877) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanol.
| Compound Name | 1-cyclopropyl-2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 80913877 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-cyclopropyl-2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]ethanol |
| SMILES | NNc1ccc([N+](=O)[O-])c(NCC(O)C2CC2)n1 |
| InChI | InChI=1S/C10H15N5O3/c11-14-9-4-3-7(15(17)18)10(13-9)12-5-8(16)6-1-2-6/h3-4,6,8,16H,1-2,5,11H2,(H2,12,13,14) |
| InChIKey | VYODTWRQFZASJC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|