C11H19N5O2 — CID 103466734
N-(2,2-dimethylbutyl)-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 103466734) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-(2,2-dimethylbutyl)-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 103466734 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(2,2-dimethylbutyl)-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | CCC(C)(C)CNc1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N5O2/c1-4-11(2,3)7-13-10-8(16(17)18)5-6-9(14-10)15-12/h5-6H,4,7,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | XWINGXHAWPOBCT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|