C10H16N6O3 — CID 114143244
3-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-3-methylbutanamide (PubChem CID 114143244) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-3-methylbutanamide.
| Compound Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 114143244 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N6O3/c1-10(2,5-7(11)17)14-9-6(16(18)19)3-4-8(13-9)15-12/h3-4H,5,12H2,1-2H3,(H2,11,17)(H2,13,14,15) |
| InChIKey | WZBJMYTVNKUNAQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|