C12H19N5O3 — CID 80819815
2-methyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide (PubChem CID 80819815) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-methyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide.
| Compound Name | 2-methyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 80819815 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-methyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide |
| SMILES | CCCNc1ccc([N+](=O)[O-])c(NC(C)(C)C(N)=O)n1 |
| InChI | InChI=1S/C12H19N5O3/c1-4-7-14-9-6-5-8(17(19)20)10(15-9)16-12(2,3)11(13)18/h5-6H,4,7H2,1-3H3,(H2,13,18)(H2,14,15,16) |
| InChIKey | NGDXRFNIHBRYKY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|