C13H21N5O3 — CID 80784224
N-ethyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide (PubChem CID 80784224) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-ethyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide.
| Compound Name | N-ethyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 80784224 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-ethyl-2-[[3-nitro-6-(propylamino)-2-pyridinyl]amino]propanamide |
| SMILES | CCCNc1ccc([N+](=O)[O-])c(NC(C)C(=O)NCC)n1 |
| InChI | InChI=1S/C13H21N5O3/c1-4-8-15-11-7-6-10(18(20)21)12(17-11)16-9(3)13(19)14-5-2/h6-7,9H,4-5,8H2,1-3H3,(H,14,19)(H2,15,16,17) |
| InChIKey | BLSDGKCKHMWLOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|