C8H14N6O4S — CID 114175800
2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-N-methylethanesulfonamide (PubChem CID 114175800) has the molecular formula C8H14N6O4S and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 114175800 |
| Molecular Formula | C8H14N6O4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N6O4S/c1-10-19(17,18)5-4-11-8-6(14(15)16)2-3-7(12-8)13-9/h2-3,10H,4-5,9H2,1H3,(H2,11,12,13) |
| InChIKey | UDWISGCIMUPBIH-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|