C7H13N7O4S — CID 106341005
2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N-methylethanesulfonamide (PubChem CID 106341005) has the molecular formula C7H13N7O4S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106341005 |
| Molecular Formula | C7H13N7O4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(6-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H13N7O4S/c1-9-19(17,18)3-2-10-6-5(14(15)16)7(13-8)12-4-11-6/h4,9H,2-3,8H2,1H3,(H2,10,11,12,13) |
| InChIKey | RZPZVKLHELWKSQ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|