C9H16N6O4S — CID 106343456
N,N-dimethyl-2-[[6-(methylamino)-5-nitropyrimidin-4-yl]amino]ethanesulfonamide (PubChem CID 106343456) has the molecular formula C9H16N6O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[[6-(methylamino)-5-nitropyrimidin-4-yl]amino]ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-[[6-(methylamino)-5-nitropyrimidin-4-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106343456 |
| Molecular Formula | C9H16N6O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N,N-dimethyl-2-[[6-(methylamino)-5-nitropyrimidin-4-yl]amino]ethanesulfonamide |
| SMILES | CNc1ncnc(NCCS(=O)(=O)N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O4S/c1-10-8-7(15(16)17)9(13-6-12-8)11-4-5-20(18,19)14(2)3/h6H,4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | USAWZWISCCTLCZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|