C9H13ClN4O4S — CID 106338860
2-[(5-chloro-3-nitro-2-pyridinyl)amino]-N,N-dimethylethanesulfonamide (PubChem CID 106338860) has the molecular formula C9H13ClN4O4S and a molecular weight of 308.75 g/mol. Its IUPAC name is 2-[(5-chloro-3-nitro-2-pyridinyl)amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(5-chloro-3-nitro-2-pyridinyl)amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106338860 |
| Molecular Formula | C9H13ClN4O4S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-[(5-chloro-3-nitro-2-pyridinyl)amino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNc1ncc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13ClN4O4S/c1-13(2)19(17,18)4-3-11-9-8(14(15)16)5-7(10)6-12-9/h5-6H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | OAAQBDNVMTXCOI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|