C11H16ClN3O2 — CID 113269101
5-chloro-N-(3,3-dimethylbutan-2-yl)-3-nitropyridin-2-amine (PubChem CID 113269101) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethylbutan-2-yl)-3-nitropyridin-2-amine.
| Compound Name | 5-chloro-N-(3,3-dimethylbutan-2-yl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 113269101 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 5-chloro-N-(3,3-dimethylbutan-2-yl)-3-nitropyridin-2-amine |
| SMILES | CC(Nc1ncc(Cl)cc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C11H16ClN3O2/c1-7(11(2,3)4)14-10-9(15(16)17)5-8(12)6-13-10/h5-7H,1-4H3,(H,13,14) |
| InChIKey | MHHXWPVJZYCFMG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|