C8H10N4O4 — CID 162519856
3,5-dinitro-N-propan-2-ylpyridin-2-amine (PubChem CID 162519856) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 3,5-dinitro-N-propan-2-ylpyridin-2-amine.
| Compound Name | 3,5-dinitro-N-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 162519856 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3,5-dinitro-N-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N4O4/c1-5(2)10-8-7(12(15)16)3-6(4-9-8)11(13)14/h3-5H,1-2H3,(H,9,10) |
| InChIKey | NCUOPOCLOBBXOF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|