C13H12N4O4 — CID 91983831
3,5-dinitro-N-[(1R)-1-phenylethyl]pyridin-2-amine (PubChem CID 91983831) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 3,5-dinitro-N-[(1R)-1-phenylethyl]pyridin-2-amine.
| Compound Name | 3,5-dinitro-N-[(1R)-1-phenylethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91983831 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3,5-dinitro-N-[(1R)-1-phenylethyl]pyridin-2-amine |
| SMILES | C[C@@H](Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C13H12N4O4/c1-9(10-5-3-2-4-6-10)15-13-12(17(20)21)7-11(8-14-13)16(18)19/h2-9H,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | ALKCAMXKWWEYAE-SECBINFHSA-N |
| XLogP | 3.07 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|