C9H8N4O8 — CID 22213334
(2S)-2-[(3,5-dinitro-2-pyridinyl)amino]butanedioic acid (PubChem CID 22213334) has the molecular formula C9H8N4O8 and a molecular weight of 300.18 g/mol. Its IUPAC name is (2S)-2-[(3,5-dinitro-2-pyridinyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(3,5-dinitro-2-pyridinyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 22213334 |
| Molecular Formula | C9H8N4O8 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | (2S)-2-[(3,5-dinitro-2-pyridinyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H8N4O8/c14-7(15)2-5(9(16)17)11-8-6(13(20)21)1-4(3-10-8)12(18)19/h1,3,5H,2H2,(H,10,11)(H,14,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | HZXBKMATSISYDL-YFKPBYRVSA-N |
| XLogP | 0.24 |
| TPSA | 185.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|