C10H8F2N2O6 — CID 115507496
2-(3,5-difluoro-2-nitroanilino)butanedioic acid (PubChem CID 115507496) has the molecular formula C10H8F2N2O6 and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-nitroanilino)butanedioic acid.
| Compound Name | 2-(3,5-difluoro-2-nitroanilino)butanedioic acid |
|---|---|
| PubChem CID | 115507496 |
| Molecular Formula | C10H8F2N2O6 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(3,5-difluoro-2-nitroanilino)butanedioic acid |
| SMILES | O=C(O)CC(Nc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H8F2N2O6/c11-4-1-5(12)9(14(19)20)6(2-4)13-7(10(17)18)3-8(15)16/h1-2,7,13H,3H2,(H,15,16)(H,17,18) |
| InChIKey | QWPFEPKGTIKWOR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|