2-(3,5-difluoro-2-nitroanilino)butanedioic acid

C10H8F2N2O6 — CID 115507496

IUPAC2-(3,5-difluoro-2-nitroanilino)butanedioic acid
SMILESO=C(O)CC(Nc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O
InChIInChI=1S/C10H8F2N2O6/c11-4-1-5(12)9(14(19)20)6(2-4)13-7(10(17)18)3-8(15)16/h1-2,7,13H,3H2,(H,15,16)(H,17,18)
InChIKeyQWPFEPKGTIKWOR-UHFFFAOYSA-N
MW290.18 g/mol
LogP1.21
Rot. Bonds6

About 2-(3,5-difluoro-2-nitroanilino)butanedioic acid

2-(3,5-difluoro-2-nitroanilino)butanedioic acid (PubChem CID 115507496) has the molecular formula C10H8F2N2O6 and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-nitroanilino)butanedioic acid.

Molecular Properties

Compound Name2-(3,5-difluoro-2-nitroanilino)butanedioic acid
PubChem CID115507496
Molecular FormulaC10H8F2N2O6
Molecular Weight290.18 g/mol
Exact Mass290.04
IUPAC Name2-(3,5-difluoro-2-nitroanilino)butanedioic acid
SMILESO=C(O)CC(Nc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O
InChIInChI=1S/C10H8F2N2O6/c11-4-1-5(12)9(14(19)20)6(2-4)13-7(10(17)18)3-8(15)16/h1-2,7,13H,3H2,(H,15,16)(H,17,18)
InChIKeyQWPFEPKGTIKWOR-UHFFFAOYSA-N
XLogP1.21
TPSA129.77 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.18
LogP ≤ 51.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(3,5-difluoro-2-nitroanilino)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-difluoro-2-nitroanilino)butanedioic acid?
The IUPAC name of 2-(3,5-difluoro-2-nitroanilino)butanedioic acid (CID 115507496) is 2-(3,5-difluoro-2-nitroanilino)butanedioic acid.
What is the SMILES notation for 2-(3,5-difluoro-2-nitroanilino)butanedioic acid?
The canonical SMILES for 2-(3,5-difluoro-2-nitroanilino)butanedioic acid is O=C(O)CC(Nc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O.
What is the InChIKey of 2-(3,5-difluoro-2-nitroanilino)butanedioic acid?
The InChIKey is QWPFEPKGTIKWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2O6/c11-4-1-5(12)9(14(19)20)6(2-4)13-7(10(17)18)3-8(15)16/h1-2,7,13H,3H2,(H,15,16)(H,17,18).
What are the key properties of 2-(3,5-difluoro-2-nitroanilino)butanedioic acid?
2-(3,5-difluoro-2-nitroanilino)butanedioic acid has a molecular weight of 290.18 g/mol, XLogP of 1.21, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluoro-2-nitroanilino)butanedioic acid is sourced from PubChem (CID 115507496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).