C11H10F2N2O5S — CID 107768586
2-acetamido-3-(3,5-difluoro-2-nitrophenyl)sulfanylpropanoic acid (PubChem CID 107768586) has the molecular formula C11H10F2N2O5S and a molecular weight of 320.27 g/mol. Its IUPAC name is 2-acetamido-3-(3,5-difluoro-2-nitrophenyl)sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(3,5-difluoro-2-nitrophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107768586 |
| Molecular Formula | C11H10F2N2O5S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-acetamido-3-(3,5-difluoro-2-nitrophenyl)sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H10F2N2O5S/c1-5(16)14-8(11(17)18)4-21-9-3-6(12)2-7(13)10(9)15(19)20/h2-3,8H,4H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | XFHAQZJGJOERIM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|