C14H18FN3O6S — CID 164874384
(2R)-3-(2-amino-5-fluoro-4-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 164874384) has the molecular formula C14H18FN3O6S and a molecular weight of 375.38 g/mol. Its IUPAC name is (2R)-3-(2-amino-5-fluoro-4-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-3-(2-amino-5-fluoro-4-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 164874384 |
| Molecular Formula | C14H18FN3O6S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (2R)-3-(2-amino-5-fluoro-4-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSc1cc(F)c([N+](=O)[O-])cc1N)C(=O)O |
| InChI | InChI=1S/C14H18FN3O6S/c1-14(2,3)24-13(21)17-9(12(19)20)6-25-11-4-7(15)10(18(22)23)5-8(11)16/h4-5,9H,6,16H2,1-3H3,(H,17,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | CNQYSWHMBFAVCC-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|