C14H17F2N3O6 — CID 68903254
3-(2,5-difluoro-4-nitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 68903254) has the molecular formula C14H17F2N3O6 and a molecular weight of 361.30 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-nitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(2,5-difluoro-4-nitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 68903254 |
| Molecular Formula | C14H17F2N3O6 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-(2,5-difluoro-4-nitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CNc1cc(F)c([N+](=O)[O-])cc1F)C(=O)O |
| InChI | InChI=1S/C14H17F2N3O6/c1-14(2,3)25-13(22)18-10(12(20)21)6-17-9-4-8(16)11(19(23)24)5-7(9)15/h4-5,10,17H,6H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | DCCUFNSJKULQNP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|