C14H16F2N2O7 — CID 118564277
(2S)-3-(3,5-difluoro-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 118564277) has the molecular formula C14H16F2N2O7 and a molecular weight of 362.29 g/mol. Its IUPAC name is (2S)-3-(3,5-difluoro-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(3,5-difluoro-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 118564277 |
| Molecular Formula | C14H16F2N2O7 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (2S)-3-(3,5-difluoro-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1cc(F)cc(F)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C14H16F2N2O7/c1-14(2,3)25-13(21)17-9(12(19)20)6-24-10-5-7(15)4-8(16)11(10)18(22)23/h4-5,9H,6H2,1-3H3,(H,17,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | MUKWRCWXRVHGPZ-VIFPVBQESA-N |
| XLogP | 2.23 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|