C17H19N3O7 — CID 162467591
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-nitroquinolin-6-yl)oxypropanoic acid (PubChem CID 162467591) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-nitroquinolin-6-yl)oxypropanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-nitroquinolin-6-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 162467591 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(5-nitroquinolin-6-yl)oxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1ccc2ncccc2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H19N3O7/c1-17(2,3)27-16(23)19-12(15(21)22)9-26-13-7-6-11-10(5-4-8-18-11)14(13)20(24)25/h4-8,12H,9H2,1-3H3,(H,19,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | IIOQARVHUUHKOB-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|