C14H19N3O7 — CID 130314077
(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitro-3-pyridinyl)oxy]butanoic acid (PubChem CID 130314077) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitro-3-pyridinyl)oxy]butanoic acid.
| Compound Name | (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitro-3-pyridinyl)oxy]butanoic acid |
|---|---|
| PubChem CID | 130314077 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitro-3-pyridinyl)oxy]butanoic acid |
| SMILES | C[C@H](Oc1cccnc1[N+](=O)[O-])[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H19N3O7/c1-8(23-9-6-5-7-15-11(9)17(21)22)10(12(18)19)16-13(20)24-14(2,3)4/h5-8,10H,1-4H3,(H,16,20)(H,18,19)/t8-,10-/m0/s1 |
| InChIKey | ZTXRGPZOEDJLQL-WPRPVWTQSA-N |
| XLogP | 1.74 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|