C15H18F3NO5 — CID 118862880
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 118862880) has the molecular formula C15H18F3NO5 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 118862880 |
| Molecular Formula | C15H18F3NO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(COc1ccccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H18F3NO5/c1-14(2,3)24-13(22)19-10(12(20)21)8-23-11-7-5-4-6-9(11)15(16,17)18/h4-7,10H,8H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | SGOXVZHXXHNFIC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |