C15H21NO5 — CID 118862902
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoate (PubChem CID 118862902) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoate |
|---|---|
| PubChem CID | 118862902 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoate |
| SMILES | COC(=O)C(COc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(18)16-12(13(17)19-4)10-20-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H,16,18) |
| InChIKey | KPICFSQUOUWSFY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |