C19H29NO5 — CID 174441374
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropoxy)phenyl]propanoate (PubChem CID 174441374) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropoxy)phenyl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 174441374 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-methylpropoxy)phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCC(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO5/c1-13(2)12-24-15-9-7-14(8-10-15)11-16(17(21)23-6)20-18(22)25-19(3,4)5/h7-10,13,16H,11-12H2,1-6H3,(H,20,22) |
| InChIKey | KXJXJDVPWOSCBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |