C14H19FN2O5 — CID 67076752
(2S)-3-(2-amino-4-fluorophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67076752) has the molecular formula C14H19FN2O5 and a molecular weight of 314.31 g/mol. Its IUPAC name is (2S)-3-(2-amino-4-fluorophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(2-amino-4-fluorophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67076752 |
| Molecular Formula | C14H19FN2O5 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2S)-3-(2-amino-4-fluorophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1ccc(F)cc1N)C(=O)O |
| InChI | InChI=1S/C14H19FN2O5/c1-14(2,3)22-13(20)17-10(12(18)19)7-21-11-5-4-8(15)6-9(11)16/h4-6,10H,7,16H2,1-3H3,(H,17,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | XEFCRFJUKAUSHS-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|