C17H24N2O5 — CID 123304231
3-(2-amino-5-cyclopropylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 123304231) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-(2-amino-5-cyclopropylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(2-amino-5-cyclopropylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 123304231 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-(2-amino-5-cyclopropylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(COc1cc(C2CC2)ccc1N)C(=O)O |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,3)24-16(22)19-13(15(20)21)9-23-14-8-11(10-4-5-10)6-7-12(14)18/h6-8,10,13H,4-5,9,18H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | PFMLONQNXHSYHA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|