C14H17BrN2O7 — CID 77267687
3-(2-bromo-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 77267687) has the molecular formula C14H17BrN2O7 and a molecular weight of 405.20 g/mol. Its IUPAC name is 3-(2-bromo-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(2-bromo-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 77267687 |
| Molecular Formula | C14H17BrN2O7 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 3-(2-bromo-6-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(COc1c(Br)cccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C14H17BrN2O7/c1-14(2,3)24-13(20)16-9(12(18)19)7-23-11-8(15)5-4-6-10(11)17(21)22/h4-6,9H,7H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | QPIFJEAPDQWUOH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|