C14H17BrN2O6S — CID 140534698
(2R)-2-(2-bromo-6-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 140534698) has the molecular formula C14H17BrN2O6S and a molecular weight of 421.27 g/mol. Its IUPAC name is (2R)-2-(2-bromo-6-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-2-(2-bromo-6-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 140534698 |
| Molecular Formula | C14H17BrN2O6S |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | (2R)-2-(2-bromo-6-nitrophenyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(Sc1c(Br)cccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C14H17BrN2O6S/c1-13(2,3)23-12(20)16-14(4,11(18)19)24-10-8(15)6-5-7-9(10)17(21)22/h5-7H,1-4H3,(H,16,20)(H,18,19)/t14-/m1/s1 |
| InChIKey | WMPSPNXZGNONBT-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|