C14H17BrN2O8 — CID 169095785
(2S)-2-(5-bromo-2-nitrophenyl)-3,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 169095785) has the molecular formula C14H17BrN2O8 and a molecular weight of 421.20 g/mol. Its IUPAC name is (2S)-2-(5-bromo-2-nitrophenyl)-3,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-2-(5-bromo-2-nitrophenyl)-3,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 169095785 |
| Molecular Formula | C14H17BrN2O8 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (2S)-2-(5-bromo-2-nitrophenyl)-3,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@](C(=O)O)(c1cc(Br)ccc1[N+](=O)[O-])C(O)O |
| InChI | InChI=1S/C14H17BrN2O8/c1-13(2,3)25-12(22)16-14(10(18)19,11(20)21)8-6-7(15)4-5-9(8)17(23)24/h4-6,10,18-19H,1-3H3,(H,16,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | DLEFKSARDMKRRS-AWEZNQCLSA-N |
| XLogP | 1.47 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|