C14H16Br2N2O7 — CID 170881320
3-(3,4-dibromo-2-hydroxy-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170881320) has the molecular formula C14H16Br2N2O7 and a molecular weight of 484.10 g/mol. Its IUPAC name is 3-(3,4-dibromo-2-hydroxy-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(3,4-dibromo-2-hydroxy-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170881320 |
| Molecular Formula | C14H16Br2N2O7 |
| Molecular Weight | 484.10 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | 3-(3,4-dibromo-2-hydroxy-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc([N+](=O)[O-])c(Br)c(Br)c1O)C(=O)O |
| InChI | InChI=1S/C14H16Br2N2O7/c1-14(2,3)25-13(22)17-7(12(20)21)4-6-5-8(18(23)24)9(15)10(16)11(6)19/h5,7,19H,4H2,1-3H3,(H,17,22)(H,20,21) |
| InChIKey | MGEQRJABVYQXGQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|