C15H18N2O7 — CID 87571962
(2S)-3-(5-formyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 87571962) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2S)-3-(5-formyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(5-formyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 87571962 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2S)-3-(5-formyl-2-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(C=O)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C15H18N2O7/c1-15(2,3)24-14(21)16-11(13(19)20)7-10-6-9(8-18)4-5-12(10)17(22)23/h4-6,8,11H,7H2,1-3H3,(H,16,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | KAVSQQNBIGCIOM-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|