C16H21BrN2O7 — CID 170881305
3-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170881305) has the molecular formula C16H21BrN2O7 and a molecular weight of 433.26 g/mol. Its IUPAC name is 3-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170881305 |
| Molecular Formula | C16H21BrN2O7 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(3-bromo-2-hydroxy-4,6-dimethyl-5-nitrophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cc1c(Br)c(O)c(CC(NC(=O)OC(C)(C)C)C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21BrN2O7/c1-7-9(13(20)11(17)8(2)12(7)19(24)25)6-10(14(21)22)18-15(23)26-16(3,4)5/h10,20H,6H2,1-5H3,(H,18,23)(H,21,22) |
| InChIKey | GPWPMYVHIZZVPM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|