C15H18F2N2O7 — CID 90344842
(2S)-3-(3,5-difluoro-4-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 90344842) has the molecular formula C15H18F2N2O7 and a molecular weight of 376.31 g/mol. Its IUPAC name is (2S)-3-(3,5-difluoro-4-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(3,5-difluoro-4-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 90344842 |
| Molecular Formula | C15H18F2N2O7 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2S)-3-(3,5-difluoro-4-methyl-2-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cc1c(F)cc(OC[C@H](NC(=O)OC(C)(C)C)C(=O)O)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C15H18F2N2O7/c1-7-8(16)5-10(12(11(7)17)19(23)24)25-6-9(13(20)21)18-14(22)26-15(2,3)4/h5,9H,6H2,1-4H3,(H,18,22)(H,20,21)/t9-/m0/s1 |
| InChIKey | BUSNPIQZZMTWJO-VIFPVBQESA-N |
| XLogP | 2.54 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|