C12H18N4O7 — CID 175026389
3-(1-methyl-4-nitropyrazol-5-yl)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 175026389) has the molecular formula C12H18N4O7 and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-(1-methyl-4-nitropyrazol-5-yl)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(1-methyl-4-nitropyrazol-5-yl)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 175026389 |
| Molecular Formula | C12H18N4O7 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(1-methyl-4-nitropyrazol-5-yl)oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cn1ncc([N+](=O)[O-])c1OCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H18N4O7/c1-12(2,3)23-11(19)14-7(10(17)18)6-22-9-8(16(20)21)5-13-15(9)4/h5,7H,6H2,1-4H3,(H,14,19)(H,17,18) |
| InChIKey | YDJYONYHSBORTE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|