C16H23N5O6S — CID 166530120
4-(3-methyl-6-nitroimidazo[4,5-b]pyridin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;sulfane (PubChem CID 166530120) has the molecular formula C16H23N5O6S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-(3-methyl-6-nitroimidazo[4,5-b]pyridin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;sulfane.
| Compound Name | 4-(3-methyl-6-nitroimidazo[4,5-b]pyridin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;sulfane |
|---|---|
| PubChem CID | 166530120 |
| Molecular Formula | C16H23N5O6S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-(3-methyl-6-nitroimidazo[4,5-b]pyridin-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid;sulfane |
| SMILES | Cn1c(CCC(NC(=O)OC(C)(C)C)C(=O)O)nc2cc([N+](=O)[O-])cnc21.S |
| InChI | InChI=1S/C16H21N5O6.H2S/c1-16(2,3)27-15(24)19-10(14(22)23)5-6-12-18-11-7-9(21(25)26)8-17-13(11)20(12)4;/h7-8,10H,5-6H2,1-4H3,(H,19,24)(H,22,23);1H2 |
| InChIKey | ADVQGZMLJGBWCY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|