C18H24N4O6 — CID 171477669
methyl (2S)-4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 171477669) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is methyl (2S)-4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2S)-4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 171477669 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl (2S)-4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@H](CCc1nc2cc([N+](=O)[O-])ccc2n1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N4O6/c1-18(2,3)28-17(24)20-12(16(23)27-5)7-9-15-19-13-10-11(22(25)26)6-8-14(13)21(15)4/h6,8,10,12H,7,9H2,1-5H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | XJGZLYVYGLPEBC-LBPRGKRZSA-N |
| XLogP | 2.48 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|