C18H26N4O7 — CID 166530143
methyl (2R)-5-[2-(methylamino)-5-nitroanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 166530143) has the molecular formula C18H26N4O7 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl (2R)-5-[2-(methylamino)-5-nitroanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | methyl (2R)-5-[2-(methylamino)-5-nitroanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 166530143 |
| Molecular Formula | C18H26N4O7 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl (2R)-5-[2-(methylamino)-5-nitroanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1NC(=O)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H26N4O7/c1-18(2,3)29-17(25)21-13(16(24)28-5)8-9-15(23)20-14-10-11(22(26)27)6-7-12(14)19-4/h6-7,10,13,19H,8-9H2,1-5H3,(H,20,23)(H,21,25)/t13-/m1/s1 |
| InChIKey | BGHWJPYTAMSOQL-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|