C24H27N3O10 — CID 135331901
2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-5-oxopentanoic acid (PubChem CID 135331901) has the molecular formula C24H27N3O10 and a molecular weight of 517.49 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-5-oxopentanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135331901 |
| Molecular Formula | C24H27N3O10 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[4-[(4-nitrophenoxy)carbonyloxymethyl]anilino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H27N3O10/c1-24(2,3)37-22(31)26-19(21(29)30)12-13-20(28)25-16-6-4-15(5-7-16)14-35-23(32)36-18-10-8-17(9-11-18)27(33)34/h4-11,19H,12-14H2,1-3H3,(H,25,28)(H,26,31)(H,29,30) |
| InChIKey | RRMXFWQCRARPPW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|