C16H20N2O9 — CID 90193200
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)carbonyloxypropanoate (PubChem CID 90193200) has the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)carbonyloxypropanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)carbonyloxypropanoate |
|---|---|
| PubChem CID | 90193200 |
| Molecular Formula | C16H20N2O9 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)carbonyloxypropanoate |
| SMILES | COC(=O)[C@H](COC(=O)Oc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20N2O9/c1-16(2,3)27-14(20)17-12(13(19)24-4)9-25-15(21)26-11-7-5-10(6-8-11)18(22)23/h5-8,12H,9H2,1-4H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | VHWGVMUFVKWGDZ-LBPRGKRZSA-N |
| XLogP | 2.18 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|