C19H26N2O9 — CID 142339580
2-(4-nitrophenoxy)carbonyloxyethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 142339580) has the molecular formula C19H26N2O9 and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)carbonyloxyethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-(4-nitrophenoxy)carbonyloxyethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 142339580 |
| Molecular Formula | C19H26N2O9 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-(4-nitrophenoxy)carbonyloxyethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H26N2O9/c1-12(2)15(20-17(23)30-19(3,4)5)16(22)27-10-11-28-18(24)29-14-8-6-13(7-9-14)21(25)26/h6-9,12,15H,10-11H2,1-5H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | SGMLQARPSKOGJN-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|