C21H30N2O8 — CID 67096838
4-O-tert-butyl 1-O-ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)butanedioate (PubChem CID 67096838) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)butanedioate |
|---|---|
| PubChem CID | 67096838 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)butanedioate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)C(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H30N2O8/c1-8-29-18(25)16(22-19(26)31-21(5,6)7)15(17(24)30-20(2,3)4)13-9-11-14(12-10-13)23(27)28/h9-12,15-16H,8H2,1-7H3,(H,22,26) |
| InChIKey | WHCIPQPYUOCFGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|