C16H22N2O6S — CID 101032628
(4-nitrophenyl)methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoate (PubChem CID 101032628) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoate |
|---|---|
| PubChem CID | 101032628 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoate |
| SMILES | CC(S)C(NC(=O)OC(C)(C)C)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O6S/c1-10(25)13(17-15(20)24-16(2,3)4)14(19)23-9-11-5-7-12(8-6-11)18(21)22/h5-8,10,13,25H,9H2,1-4H3,(H,17,20) |
| InChIKey | DACSDQYOVPTSDL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|