C23H37N2O10P — CID 14061052
(4-nitrophenyl)methyl 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 14061052) has the molecular formula C23H37N2O10P and a molecular weight of 532.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 14061052 |
| Molecular Formula | C23H37N2O10P |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(COP(=O)(OC(C)(C)C)OC(C)(C)C)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H37N2O10P/c1-21(2,3)33-20(27)24-18(15-32-36(30,34-22(4,5)6)35-23(7,8)9)19(26)31-14-16-10-12-17(13-11-16)25(28)29/h10-13,18H,14-15H2,1-9H3,(H,24,27) |
| InChIKey | BRWHKVGELHFUKY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|