C23H25N3O10 — CID 177069182
4-O-benzyl 1-O-[(3,5-dinitrophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 177069182) has the molecular formula C23H25N3O10 and a molecular weight of 503.46 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[(3,5-dinitrophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-benzyl 1-O-[(3,5-dinitrophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 177069182 |
| Molecular Formula | C23H25N3O10 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-O-benzyl 1-O-[(3,5-dinitrophenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCc1ccccc1)C(=O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N3O10/c1-23(2,3)36-22(29)24-19(12-20(27)34-13-15-7-5-4-6-8-15)21(28)35-14-16-9-17(25(30)31)11-18(10-16)26(32)33/h4-11,19H,12-14H2,1-3H3,(H,24,29)/t19-/m0/s1 |
| InChIKey | DBMPXPVMKBFVFD-IBGZPJMESA-N |
| XLogP | 3.57 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|