C22H23N3O10 — CID 177069183
1-O-[(3,5-dinitrophenyl)methyl] 4-O-phenyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 177069183) has the molecular formula C22H23N3O10 and a molecular weight of 489.44 g/mol. Its IUPAC name is 1-O-[(3,5-dinitrophenyl)methyl] 4-O-phenyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 1-O-[(3,5-dinitrophenyl)methyl] 4-O-phenyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 177069183 |
| Molecular Formula | C22H23N3O10 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-O-[(3,5-dinitrophenyl)methyl] 4-O-phenyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)Oc1ccccc1)C(=O)OCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N3O10/c1-22(2,3)35-21(28)23-18(12-19(26)34-17-7-5-4-6-8-17)20(27)33-13-14-9-15(24(29)30)11-16(10-14)25(31)32/h4-11,18H,12-13H2,1-3H3,(H,23,28)/t18-/m0/s1 |
| InChIKey | MMMWRZWTLCIHDK-SFHVURJKSA-N |
| XLogP | 3.44 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|