C14H18N2O9S — CID 12508776
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)-3-oxopropane-1-sulfonic acid (PubChem CID 12508776) has the molecular formula C14H18N2O9S and a molecular weight of 390.37 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 12508776 |
| Molecular Formula | C14H18N2O9S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenoxy)-3-oxopropane-1-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CS(=O)(=O)O)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O9S/c1-14(2,3)25-13(18)15-11(8-26(21,22)23)12(17)24-10-6-4-9(5-7-10)16(19)20/h4-7,11H,8H2,1-3H3,(H,15,18)(H,21,22,23)/t11-/m0/s1 |
| InChIKey | BMPISBAVIZBOQN-NSHDSACASA-N |
| XLogP | 1.28 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|